About [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)ethyl]phenyl] acetate
[4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)ethyl]phenyl] acetate (PubChem CID 18760540) has the molecular formula C24H38N2O3
and a molecular weight of 402.58 g/mol. Its IUPAC name is [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)ethyl]phenyl] acetate.
Molecular Properties
| Compound Name | [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)ethyl]phenyl] acetate |
| PubChem CID | 18760540 |
| Molecular Formula | C24H38N2O3 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)ethyl]phenyl] acetate |
| SMILES | CCC1(CC)C(=O)N(C(C)(C)C)CC(C)(C)N1C(C)c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C24H38N2O3/c1-10-24(11-2)21(28)25(22(5,6)7)16-23(8,9)26(24)17(3)19-12-14-20(15-13-19)29-18(4)27/h12-15,17H,10-11,16H2,1-9H3 |
| InChIKey | NWONEONLZLBCFM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)ethyl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)ethyl]phenyl] acetate?
The IUPAC name of [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)ethyl]phenyl] acetate (CID 18760540) is [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)ethyl]phenyl] acetate.
What is the SMILES notation for [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)ethyl]phenyl] acetate?
The canonical SMILES for [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)ethyl]phenyl] acetate is CCC1(CC)C(=O)N(C(C)(C)C)CC(C)(C)N1C(C)c1ccc(OC(C)=O)cc1.
What is the InChIKey of [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)ethyl]phenyl] acetate?
The InChIKey is NWONEONLZLBCFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H38N2O3/c1-10-24(11-2)21(28)25(22(5,6)7)16-23(8,9)26(24)17(3)19-12-14-20(15-13-19)29-18(4)27/h12-15,17H,10-11,16H2,1-9H3.
What are the key properties of [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)ethyl]phenyl] acetate?
[4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)ethyl]phenyl] acetate has a molecular weight of 402.58 g/mol, XLogP of 4.95, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)ethyl]phenyl] acetate is sourced from PubChem (CID 18760540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).