C17H10F26O4S2 — CID 18760760
1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluoro-1-(1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctylsulfonylmethylsulfonyl)octane (PubChem CID 18760760) has the molecular formula C17H10F26O4S2 and a molecular weight of 836.34 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluoro-1-(1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctylsulfonylmethylsulfonyl)octane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluoro-1-(1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctylsulfonylmethylsulfonyl)octane |
|---|---|
| PubChem CID | 18760760 |
| Molecular Formula | C17H10F26O4S2 |
| Molecular Weight | 836.34 g/mol |
| Exact Mass | 835.96 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluoro-1-(1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctylsulfonylmethylsulfonyl)octane |
| SMILES | CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)CS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)F |
| InChI | InChI=1S/C17H10F26O4S2/c1-4(18)6(20,21)8(24,25)10(28,29)12(32,33)14(36,37)16(40,41)48(44,45)3-49(46,47)17(42,43)15(38,39)13(34,35)11(30,31)9(26,27)7(22,23)5(2)19/h4-5H,3H2,1-2H3 |
| InChIKey | OHBUXTVJSRNLNM-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.34 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|