C40H33F3N4OS — CID 18761359
5-pyridin-2-yl-2-[2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidin-1-yl]pyrimidine (PubChem CID 18761359) has the molecular formula C40H33F3N4OS and a molecular weight of 674.79 g/mol. Its IUPAC name is 5-pyridin-2-yl-2-[2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidin-1-yl]pyrimidine.
| Compound Name | 5-pyridin-2-yl-2-[2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 18761359 |
| Molecular Formula | C40H33F3N4OS |
| Molecular Weight | 674.79 g/mol |
| Exact Mass | 674.23 |
| IUPAC Name | 5-pyridin-2-yl-2-[2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidin-1-yl]pyrimidine |
| SMILES | Fc1cc(F)c(COCC2CC(SC(c3ccccc3)(c3ccccc3)c3ccccc3)CN2c2ncc(-c3ccccn3)cn2)cc1F |
| InChI | InChI=1S/C40H33F3N4OS/c41-35-22-37(43)36(42)20-28(35)26-48-27-33-21-34(25-47(33)39-45-23-29(24-46-39)38-18-10-11-19-44-38)49-40(30-12-4-1-5-13-30,31-14-6-2-7-15-31)32-16-8-3-9-17-32/h1-20,22-24,33-34H,21,25-27H2 |
| InChIKey | YPGNEWSOTCEGHD-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.79 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|