About 4-amino-N-(5-oxo-4,4-dipropyloxolan-3-yl)benzenesulfonamide
4-amino-N-(5-oxo-4,4-dipropyloxolan-3-yl)benzenesulfonamide (PubChem CID 18761661) has the molecular formula C16H24N2O4S
and a molecular weight of 340.44 g/mol. Its IUPAC name is 4-amino-N-(5-oxo-4,4-dipropyloxolan-3-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-amino-N-(5-oxo-4,4-dipropyloxolan-3-yl)benzenesulfonamide |
| PubChem CID | 18761661 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 4-amino-N-(5-oxo-4,4-dipropyloxolan-3-yl)benzenesulfonamide |
| SMILES | CCCC1(CCC)C(=O)OCC1NS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H24N2O4S/c1-3-9-16(10-4-2)14(11-22-15(16)19)18-23(20,21)13-7-5-12(17)6-8-13/h5-8,14,18H,3-4,9-11,17H2,1-2H3 |
| InChIKey | MPZZRXXEZNJWGR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-(5-oxo-4,4-dipropyloxolan-3-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(5-oxo-4,4-dipropyloxolan-3-yl)benzenesulfonamide?
The IUPAC name of 4-amino-N-(5-oxo-4,4-dipropyloxolan-3-yl)benzenesulfonamide (CID 18761661) is 4-amino-N-(5-oxo-4,4-dipropyloxolan-3-yl)benzenesulfonamide.
What is the SMILES notation for 4-amino-N-(5-oxo-4,4-dipropyloxolan-3-yl)benzenesulfonamide?
The canonical SMILES for 4-amino-N-(5-oxo-4,4-dipropyloxolan-3-yl)benzenesulfonamide is CCCC1(CCC)C(=O)OCC1NS(=O)(=O)c1ccc(N)cc1.
What is the InChIKey of 4-amino-N-(5-oxo-4,4-dipropyloxolan-3-yl)benzenesulfonamide?
The InChIKey is MPZZRXXEZNJWGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O4S/c1-3-9-16(10-4-2)14(11-22-15(16)19)18-23(20,21)13-7-5-12(17)6-8-13/h5-8,14,18H,3-4,9-11,17H2,1-2H3.
What are the key properties of 4-amino-N-(5-oxo-4,4-dipropyloxolan-3-yl)benzenesulfonamide?
4-amino-N-(5-oxo-4,4-dipropyloxolan-3-yl)benzenesulfonamide has a molecular weight of 340.44 g/mol, XLogP of 2.06, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(5-oxo-4,4-dipropyloxolan-3-yl)benzenesulfonamide is sourced from PubChem (CID 18761661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).