About 4-amino-3,3-dipropyloxolan-2-one
4-amino-3,3-dipropyloxolan-2-one (PubChem CID 18761664) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 4-amino-3,3-dipropyloxolan-2-one.
Molecular Properties
| Compound Name | 4-amino-3,3-dipropyloxolan-2-one |
| PubChem CID | 18761664 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 4-amino-3,3-dipropyloxolan-2-one |
| SMILES | CCCC1(CCC)C(=O)OCC1N |
| InChI | InChI=1S/C10H19NO2/c1-3-5-10(6-4-2)8(11)7-13-9(10)12/h8H,3-7,11H2,1-2H3 |
| InChIKey | ODVNBMIWEGMQQL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-3,3-dipropyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3,3-dipropyloxolan-2-one?
The IUPAC name of 4-amino-3,3-dipropyloxolan-2-one (CID 18761664) is 4-amino-3,3-dipropyloxolan-2-one.
What is the SMILES notation for 4-amino-3,3-dipropyloxolan-2-one?
The canonical SMILES for 4-amino-3,3-dipropyloxolan-2-one is CCCC1(CCC)C(=O)OCC1N.
What is the InChIKey of 4-amino-3,3-dipropyloxolan-2-one?
The InChIKey is ODVNBMIWEGMQQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-3-5-10(6-4-2)8(11)7-13-9(10)12/h8H,3-7,11H2,1-2H3.
What are the key properties of 4-amino-3,3-dipropyloxolan-2-one?
4-amino-3,3-dipropyloxolan-2-one has a molecular weight of 185.27 g/mol, XLogP of 1.46, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,3-dipropyloxolan-2-one is sourced from PubChem (CID 18761664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).