About 5,7,10-trimethyl-2,3-diphenylphenazine
5,7,10-trimethyl-2,3-diphenylphenazine (PubChem CID 18761853) has the molecular formula C27H24N2
and a molecular weight of 376.50 g/mol. Its IUPAC name is 5,7,10-trimethyl-2,3-diphenylphenazine.
Molecular Properties
| Compound Name | 5,7,10-trimethyl-2,3-diphenylphenazine |
| PubChem CID | 18761853 |
| Molecular Formula | C27H24N2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 5,7,10-trimethyl-2,3-diphenylphenazine |
| SMILES | Cc1ccc2c(c1)N(C)c1cc(-c3ccccc3)c(-c3ccccc3)cc1N2C |
| InChI | InChI=1S/C27H24N2/c1-19-14-15-24-25(16-19)29(3)27-18-23(21-12-8-5-9-13-21)22(17-26(27)28(24)2)20-10-6-4-7-11-20/h4-18H,1-3H3 |
| InChIKey | WUBKQOISUAZGOH-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7,10-trimethyl-2,3-diphenylphenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7,10-trimethyl-2,3-diphenylphenazine?
The IUPAC name of 5,7,10-trimethyl-2,3-diphenylphenazine (CID 18761853) is 5,7,10-trimethyl-2,3-diphenylphenazine.
What is the SMILES notation for 5,7,10-trimethyl-2,3-diphenylphenazine?
The canonical SMILES for 5,7,10-trimethyl-2,3-diphenylphenazine is Cc1ccc2c(c1)N(C)c1cc(-c3ccccc3)c(-c3ccccc3)cc1N2C.
What is the InChIKey of 5,7,10-trimethyl-2,3-diphenylphenazine?
The InChIKey is WUBKQOISUAZGOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24N2/c1-19-14-15-24-25(16-19)29(3)27-18-23(21-12-8-5-9-13-21)22(17-26(27)28(24)2)20-10-6-4-7-11-20/h4-18H,1-3H3.
What are the key properties of 5,7,10-trimethyl-2,3-diphenylphenazine?
5,7,10-trimethyl-2,3-diphenylphenazine has a molecular weight of 376.50 g/mol, XLogP of 7.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7,10-trimethyl-2,3-diphenylphenazine is sourced from PubChem (CID 18761853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).