About 2-(2-methoxyethoxy)-1,3-bis[2-(2-methoxyethoxy)ethoxy]propane
2-(2-methoxyethoxy)-1,3-bis[2-(2-methoxyethoxy)ethoxy]propane (PubChem CID 18761885) has the molecular formula C16H34O8
and a molecular weight of 354.44 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-1,3-bis[2-(2-methoxyethoxy)ethoxy]propane.
Molecular Properties
| Compound Name | 2-(2-methoxyethoxy)-1,3-bis[2-(2-methoxyethoxy)ethoxy]propane |
| PubChem CID | 18761885 |
| Molecular Formula | C16H34O8 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 2-(2-methoxyethoxy)-1,3-bis[2-(2-methoxyethoxy)ethoxy]propane |
| SMILES | COCCOCCOCC(COCCOCCOC)OCCOC |
| InChI | InChI=1S/C16H34O8/c1-17-4-7-20-9-11-22-14-16(24-13-6-19-3)15-23-12-10-21-8-5-18-2/h16H,4-15H2,1-3H3 |
| InChIKey | DYHCYTJXOWUORG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyethoxy)-1,3-bis[2-(2-methoxyethoxy)ethoxy]propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethoxy)-1,3-bis[2-(2-methoxyethoxy)ethoxy]propane?
The IUPAC name of 2-(2-methoxyethoxy)-1,3-bis[2-(2-methoxyethoxy)ethoxy]propane (CID 18761885) is 2-(2-methoxyethoxy)-1,3-bis[2-(2-methoxyethoxy)ethoxy]propane.
What is the SMILES notation for 2-(2-methoxyethoxy)-1,3-bis[2-(2-methoxyethoxy)ethoxy]propane?
The canonical SMILES for 2-(2-methoxyethoxy)-1,3-bis[2-(2-methoxyethoxy)ethoxy]propane is COCCOCCOCC(COCCOCCOC)OCCOC.
What is the InChIKey of 2-(2-methoxyethoxy)-1,3-bis[2-(2-methoxyethoxy)ethoxy]propane?
The InChIKey is DYHCYTJXOWUORG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O8/c1-17-4-7-20-9-11-22-14-16(24-13-6-19-3)15-23-12-10-21-8-5-18-2/h16H,4-15H2,1-3H3.
What are the key properties of 2-(2-methoxyethoxy)-1,3-bis[2-(2-methoxyethoxy)ethoxy]propane?
2-(2-methoxyethoxy)-1,3-bis[2-(2-methoxyethoxy)ethoxy]propane has a molecular weight of 354.44 g/mol, XLogP of 0.38, 20 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethoxy)-1,3-bis[2-(2-methoxyethoxy)ethoxy]propane is sourced from PubChem (CID 18761885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).