About 4,5,6-triethoxypyrimidine
4,5,6-triethoxypyrimidine (PubChem CID 18761898) has the molecular formula C10H16N2O3
and a molecular weight of 212.25 g/mol. Its IUPAC name is 4,5,6-triethoxypyrimidine.
Molecular Properties
| Compound Name | 4,5,6-triethoxypyrimidine |
| PubChem CID | 18761898 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 4,5,6-triethoxypyrimidine |
| SMILES | CCOc1ncnc(OCC)c1OCC |
| InChI | InChI=1S/C10H16N2O3/c1-4-13-8-9(14-5-2)11-7-12-10(8)15-6-3/h7H,4-6H2,1-3H3 |
| InChIKey | RBHLJEJYIGDEGT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5,6-triethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6-triethoxypyrimidine?
The IUPAC name of 4,5,6-triethoxypyrimidine (CID 18761898) is 4,5,6-triethoxypyrimidine.
What is the SMILES notation for 4,5,6-triethoxypyrimidine?
The canonical SMILES for 4,5,6-triethoxypyrimidine is CCOc1ncnc(OCC)c1OCC.
What is the InChIKey of 4,5,6-triethoxypyrimidine?
The InChIKey is RBHLJEJYIGDEGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3/c1-4-13-8-9(14-5-2)11-7-12-10(8)15-6-3/h7H,4-6H2,1-3H3.
What are the key properties of 4,5,6-triethoxypyrimidine?
4,5,6-triethoxypyrimidine has a molecular weight of 212.25 g/mol, XLogP of 1.67, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6-triethoxypyrimidine is sourced from PubChem (CID 18761898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).