About [2,3-bis(hydroxymethyl)cyclopropyl]methanol
[2,3-bis(hydroxymethyl)cyclopropyl]methanol (PubChem CID 18762355) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is [2,3-bis(hydroxymethyl)cyclopropyl]methanol.
Molecular Properties
| Compound Name | [2,3-bis(hydroxymethyl)cyclopropyl]methanol |
| PubChem CID | 18762355 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | [2,3-bis(hydroxymethyl)cyclopropyl]methanol |
| SMILES | OCC1C(CO)C1CO |
| InChI | InChI=1S/C6H12O3/c7-1-4-5(2-8)6(4)3-9/h4-9H,1-3H2 |
| InChIKey | QTWWLLXOSUKTQH-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2,3-bis(hydroxymethyl)cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-bis(hydroxymethyl)cyclopropyl]methanol?
The IUPAC name of [2,3-bis(hydroxymethyl)cyclopropyl]methanol (CID 18762355) is [2,3-bis(hydroxymethyl)cyclopropyl]methanol.
What is the SMILES notation for [2,3-bis(hydroxymethyl)cyclopropyl]methanol?
The canonical SMILES for [2,3-bis(hydroxymethyl)cyclopropyl]methanol is OCC1C(CO)C1CO.
What is the InChIKey of [2,3-bis(hydroxymethyl)cyclopropyl]methanol?
The InChIKey is QTWWLLXOSUKTQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3/c7-1-4-5(2-8)6(4)3-9/h4-9H,1-3H2.
What are the key properties of [2,3-bis(hydroxymethyl)cyclopropyl]methanol?
[2,3-bis(hydroxymethyl)cyclopropyl]methanol has a molecular weight of 132.16 g/mol, XLogP of -1.17, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-bis(hydroxymethyl)cyclopropyl]methanol is sourced from PubChem (CID 18762355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).