C12H13NO2S — CID 18762678
3-(phenylsulfanylmethyl)piperidine-2,6-dione (PubChem CID 18762678) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 3-(phenylsulfanylmethyl)piperidine-2,6-dione.
| Compound Name | 3-(phenylsulfanylmethyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 18762678 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 3-(phenylsulfanylmethyl)piperidine-2,6-dione |
| SMILES | O=C1CCC(CSc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C12H13NO2S/c14-11-7-6-9(12(15)13-11)8-16-10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H,13,14,15) |
| InChIKey | UGQNTSHUUBOKQL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|