About 2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)acetamide
2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)acetamide (PubChem CID 18763791) has the molecular formula C7H11N2OS+
and a molecular weight of 171.25 g/mol. Its IUPAC name is 2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)acetamide |
| PubChem CID | 18763791 |
| Molecular Formula | C7H11N2OS+ |
| Molecular Weight | 171.25 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)acetamide |
| SMILES | Cc1sc[n+](CC(N)=O)c1C |
| InChI | InChI=1S/C7H10N2OS/c1-5-6(2)11-4-9(5)3-7(8)10/h4H,3H2,1-2H3,(H-,8,10)/p+1 |
| InChIKey | VTYPUAQJVKNOHM-UHFFFAOYSA-O |
| XLogP | 0.14 |
| TPSA | 46.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)acetamide?
The IUPAC name of 2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)acetamide (CID 18763791) is 2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)acetamide.
What is the SMILES notation for 2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)acetamide?
The canonical SMILES for 2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)acetamide is Cc1sc[n+](CC(N)=O)c1C.
What is the InChIKey of 2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)acetamide?
The InChIKey is VTYPUAQJVKNOHM-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H10N2OS/c1-5-6(2)11-4-9(5)3-7(8)10/h4H,3H2,1-2H3,(H-,8,10)/p+1.
What are the key properties of 2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)acetamide?
2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)acetamide has a molecular weight of 171.25 g/mol, XLogP of 0.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)acetamide is sourced from PubChem (CID 18763791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).