About 4-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]benzoic acid
4-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]benzoic acid (PubChem CID 18764592) has the molecular formula C21H23N3O8
and a molecular weight of 445.43 g/mol. Its IUPAC name is 4-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]benzoic acid |
| PubChem CID | 18764592 |
| Molecular Formula | C21H23N3O8 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 4-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]benzoic acid |
| SMILES | CC(=O)OCCOc1cc(/N=N/c2ccc(C(=O)O)cc2)c(OCCOC(C)=O)cc1N |
| InChI | InChI=1S/C21H23N3O8/c1-13(25)29-7-9-31-19-12-18(20(11-17(19)22)32-10-8-30-14(2)26)24-23-16-5-3-15(4-6-16)21(27)28/h3-6,11-12H,7-10,22H2,1-2H3,(H,27,28)/b24-23+ |
| InChIKey | QLKBJRIMVXNTHN-WCWDXBQESA-N |
| XLogP | 3.27 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]benzoic acid?
The IUPAC name of 4-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]benzoic acid (CID 18764592) is 4-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]benzoic acid.
What is the SMILES notation for 4-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]benzoic acid?
The canonical SMILES for 4-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]benzoic acid is CC(=O)OCCOc1cc(/N=N/c2ccc(C(=O)O)cc2)c(OCCOC(C)=O)cc1N.
What is the InChIKey of 4-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]benzoic acid?
The InChIKey is QLKBJRIMVXNTHN-WCWDXBQESA-N. The full InChI is InChI=1S/C21H23N3O8/c1-13(25)29-7-9-31-19-12-18(20(11-17(19)22)32-10-8-30-14(2)26)24-23-16-5-3-15(4-6-16)21(27)28/h3-6,11-12H,7-10,22H2,1-2H3,(H,27,28)/b24-23+.
What are the key properties of 4-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]benzoic acid?
4-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]benzoic acid has a molecular weight of 445.43 g/mol, XLogP of 3.27, 11 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]benzoic acid is sourced from PubChem (CID 18764592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).