C19H20N4S — CID 18765759
N'-[4-[2-(pyridin-4-ylmethylamino)ethyl]phenyl]thiophene-2-carboximidamide (PubChem CID 18765759) has the molecular formula C19H20N4S and a molecular weight of 336.46 g/mol. Its IUPAC name is N'-[4-[2-(pyridin-4-ylmethylamino)ethyl]phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[4-[2-(pyridin-4-ylmethylamino)ethyl]phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 18765759 |
| Molecular Formula | C19H20N4S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N'-[4-[2-(pyridin-4-ylmethylamino)ethyl]phenyl]thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc(CCNCc2ccncc2)cc1)c1cccs1 |
| InChI | InChI=1S/C19H20N4S/c20-19(18-2-1-13-24-18)23-17-5-3-15(4-6-17)7-12-22-14-16-8-10-21-11-9-16/h1-6,8-11,13,22H,7,12,14H2,(H2,20,23) |
| InChIKey | NKVCOKNFSLBVGX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|