About N',N'-diethylacetohydrazide
N',N'-diethylacetohydrazide (PubChem CID 18766757) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is N',N'-diethylacetohydrazide.
Molecular Properties
| Compound Name | N',N'-diethylacetohydrazide |
| PubChem CID | 18766757 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | N',N'-diethylacetohydrazide |
| SMILES | CCN(CC)NC(C)=O |
| InChI | InChI=1S/C6H14N2O/c1-4-8(5-2)7-6(3)9/h4-5H2,1-3H3,(H,7,9) |
| InChIKey | FADVVFDMPOBUMA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N',N'-diethylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-diethylacetohydrazide?
The IUPAC name of N',N'-diethylacetohydrazide (CID 18766757) is N',N'-diethylacetohydrazide.
What is the SMILES notation for N',N'-diethylacetohydrazide?
The canonical SMILES for N',N'-diethylacetohydrazide is CCN(CC)NC(C)=O.
What is the InChIKey of N',N'-diethylacetohydrazide?
The InChIKey is FADVVFDMPOBUMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O/c1-4-8(5-2)7-6(3)9/h4-5H2,1-3H3,(H,7,9).
What are the key properties of N',N'-diethylacetohydrazide?
N',N'-diethylacetohydrazide has a molecular weight of 130.19 g/mol, XLogP of 0.38, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-diethylacetohydrazide is sourced from PubChem (CID 18766757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).