About cyclohexa-1,5-dien-1-ylmethylurea
cyclohexa-1,5-dien-1-ylmethylurea (PubChem CID 18766888) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethylurea.
Molecular Properties
| Compound Name | cyclohexa-1,5-dien-1-ylmethylurea |
| PubChem CID | 18766888 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethylurea |
| SMILES | NC(=O)NCC1=CCCC=C1 |
| InChI | InChI=1S/C8H12N2O/c9-8(11)10-6-7-4-2-1-3-5-7/h2,4-5H,1,3,6H2,(H3,9,10,11) |
| InChIKey | XGENBBBGUZNLPN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohexa-1,5-dien-1-ylmethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,5-dien-1-ylmethylurea?
The IUPAC name of cyclohexa-1,5-dien-1-ylmethylurea (CID 18766888) is cyclohexa-1,5-dien-1-ylmethylurea.
What is the SMILES notation for cyclohexa-1,5-dien-1-ylmethylurea?
The canonical SMILES for cyclohexa-1,5-dien-1-ylmethylurea is NC(=O)NCC1=CCCC=C1.
What is the InChIKey of cyclohexa-1,5-dien-1-ylmethylurea?
The InChIKey is XGENBBBGUZNLPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c9-8(11)10-6-7-4-2-1-3-5-7/h2,4-5H,1,3,6H2,(H3,9,10,11).
What are the key properties of cyclohexa-1,5-dien-1-ylmethylurea?
cyclohexa-1,5-dien-1-ylmethylurea has a molecular weight of 152.20 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,5-dien-1-ylmethylurea is sourced from PubChem (CID 18766888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).