C23H36O6 — CID 18766960
3-ethyl-3,9-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)-1,5,7,11-tetraoxaspiro[5.5]undecane (PubChem CID 18766960) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is 3-ethyl-3,9-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)-1,5,7,11-tetraoxaspiro[5.5]undecane.
| Compound Name | 3-ethyl-3,9-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)-1,5,7,11-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 18766960 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 3-ethyl-3,9-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)-1,5,7,11-tetraoxaspiro[5.5]undecane |
| SMILES | CCC1(CC2CCC3OC3C2)COC2(OCC(CC3CCC4OC4C3)CO2)OC1 |
| InChI | InChI=1S/C23H36O6/c1-2-22(10-16-4-6-19-21(9-16)29-19)13-26-23(27-14-22)24-11-17(12-25-23)7-15-3-5-18-20(8-15)28-18/h15-21H,2-14H2,1H3 |
| InChIKey | YGJKJOSAFRUJRI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|