About 2,6-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-4-methylphenol
2,6-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-4-methylphenol (PubChem CID 18767359) has the molecular formula C33H34N6O
and a molecular weight of 530.68 g/mol. Its IUPAC name is 2,6-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-4-methylphenol.
Molecular Properties
| Compound Name | 2,6-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-4-methylphenol |
| PubChem CID | 18767359 |
| Molecular Formula | C33H34N6O |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 2,6-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-4-methylphenol |
| SMILES | Cc1cc(C(N)(Cc2ccccn2)Cc2ccccn2)c(O)c(C(N)(Cc2ccccn2)Cc2ccccn2)c1 |
| InChI | InChI=1S/C33H34N6O/c1-24-18-29(32(34,20-25-10-2-6-14-36-25)21-26-11-3-7-15-37-26)31(40)30(19-24)33(35,22-27-12-4-8-16-38-27)23-28-13-5-9-17-39-28/h2-19,40H,20-23,34-35H2,1H3 |
| InChIKey | KVVDHYCXDRKBEU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 123.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-4-methylphenol?
The IUPAC name of 2,6-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-4-methylphenol (CID 18767359) is 2,6-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-4-methylphenol.
What is the SMILES notation for 2,6-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-4-methylphenol?
The canonical SMILES for 2,6-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-4-methylphenol is Cc1cc(C(N)(Cc2ccccn2)Cc2ccccn2)c(O)c(C(N)(Cc2ccccn2)Cc2ccccn2)c1.
What is the InChIKey of 2,6-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-4-methylphenol?
The InChIKey is KVVDHYCXDRKBEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H34N6O/c1-24-18-29(32(34,20-25-10-2-6-14-36-25)21-26-11-3-7-15-37-26)31(40)30(19-24)33(35,22-27-12-4-8-16-38-27)23-28-13-5-9-17-39-28/h2-19,40H,20-23,34-35H2,1H3.
What are the key properties of 2,6-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-4-methylphenol?
2,6-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-4-methylphenol has a molecular weight of 530.68 g/mol, XLogP of 4.56, 10 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-4-methylphenol is sourced from PubChem (CID 18767359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).