C9H8FN7O2S — CID 18767596
2-amino-3,7-dihydropurine-6-thione;1-fluoropyrimidine-2,4-dione (PubChem CID 18767596) has the molecular formula C9H8FN7O2S and a molecular weight of 297.28 g/mol. Its IUPAC name is 2-amino-3,7-dihydropurine-6-thione;1-fluoropyrimidine-2,4-dione.
| Compound Name | 2-amino-3,7-dihydropurine-6-thione;1-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 18767596 |
| Molecular Formula | C9H8FN7O2S |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-amino-3,7-dihydropurine-6-thione;1-fluoropyrimidine-2,4-dione |
| SMILES | Nc1nc(=S)c2[nH]cnc2[nH]1.O=c1ccn(F)c(=O)[nH]1 |
| InChI | InChI=1S/C5H5N5S.C4H3FN2O2/c6-5-9-3-2(4(11)10-5)7-1-8-3;5-7-2-1-3(8)6-4(7)9/h1H,(H4,6,7,8,9,10,11);1-2H,(H,6,8,9) |
| InChIKey | ZRVGUHCJEGRSEO-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 138.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|