C25H38NO2+ — CID 18768
diethyl-methyl-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propoxy]ethyl]azanium (PubChem CID 18768) has the molecular formula C25H38NO2+ and a molecular weight of 384.58 g/mol. Its IUPAC name is diethyl-methyl-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propoxy]ethyl]azanium.
| Compound Name | diethyl-methyl-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propoxy]ethyl]azanium |
|---|---|
| PubChem CID | 18768 |
| Molecular Formula | C25H38NO2+ |
| Molecular Weight | 384.58 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | diethyl-methyl-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propoxy]ethyl]azanium |
| SMILES | CC[N+](C)(CC)CCOCC(Cc1cccc2ccccc12)CC1CCCO1 |
| InChI | InChI=1S/C25H38NO2/c1-4-26(3,5-2)15-17-27-20-21(19-24-13-9-16-28-24)18-23-12-8-11-22-10-6-7-14-25(22)23/h6-8,10-12,14,21,24H,4-5,9,13,15-20H2,1-3H3/q+1 |
| InChIKey | JJYFGCMZUABGIG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|