C29H29F3O5S — CID 18768153
methyl 4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethylsulfonyloxy)phenyl]benzoate (PubChem CID 18768153) has the molecular formula C29H29F3O5S and a molecular weight of 546.61 g/mol. Its IUPAC name is methyl 4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethylsulfonyloxy)phenyl]benzoate.
| Compound Name | methyl 4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethylsulfonyloxy)phenyl]benzoate |
|---|---|
| PubChem CID | 18768153 |
| Molecular Formula | C29H29F3O5S |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | methyl 4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethylsulfonyloxy)phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(OS(=O)(=O)C(F)(F)F)c(-c3ccc4c(c3)C(C)(C)CCC4(C)C)c2)cc1 |
| InChI | InChI=1S/C29H29F3O5S/c1-27(2)14-15-28(3,4)24-17-21(10-12-23(24)27)22-16-20(18-6-8-19(9-7-18)26(33)36-5)11-13-25(22)37-38(34,35)29(30,31)32/h6-13,16-17H,14-15H2,1-5H3 |
| InChIKey | DDTOOOYRBVQYBP-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|