C30H31F3O5S — CID 18768167
ethyl 4-[5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-(trifluoromethylsulfonyloxy)phenyl]benzoate (PubChem CID 18768167) has the molecular formula C30H31F3O5S and a molecular weight of 560.63 g/mol. Its IUPAC name is ethyl 4-[5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-(trifluoromethylsulfonyloxy)phenyl]benzoate.
| Compound Name | ethyl 4-[5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-(trifluoromethylsulfonyloxy)phenyl]benzoate |
|---|---|
| PubChem CID | 18768167 |
| Molecular Formula | C30H31F3O5S |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | ethyl 4-[5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-(trifluoromethylsulfonyloxy)phenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2cc(-c3ccc4c(c3)C(C)(C)CCC4(C)C)ccc2OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H31F3O5S/c1-6-37-27(34)20-9-7-19(8-10-20)23-17-21(12-14-26(23)38-39(35,36)30(31,32)33)22-11-13-24-25(18-22)29(4,5)16-15-28(24,2)3/h7-14,17-18H,6,15-16H2,1-5H3 |
| InChIKey | XIFZBEJBOQXHQG-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|