C32H35F3O7S — CID 18768178
ethyl 4-[3-[3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-4-(trifluoromethylsulfonyloxy)phenyl]benzoate (PubChem CID 18768178) has the molecular formula C32H35F3O7S and a molecular weight of 620.69 g/mol. Its IUPAC name is ethyl 4-[3-[3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-4-(trifluoromethylsulfonyloxy)phenyl]benzoate.
| Compound Name | ethyl 4-[3-[3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-4-(trifluoromethylsulfonyloxy)phenyl]benzoate |
|---|---|
| PubChem CID | 18768178 |
| Molecular Formula | C32H35F3O7S |
| Molecular Weight | 620.69 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | ethyl 4-[3-[3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-4-(trifluoromethylsulfonyloxy)phenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(OS(=O)(=O)C(F)(F)F)c(-c3cc4c(cc3OCOC)C(C)(C)CCC4(C)C)c2)cc1 |
| InChI | InChI=1S/C32H35F3O7S/c1-7-40-29(36)21-10-8-20(9-11-21)22-12-13-27(42-43(37,38)32(33,34)35)23(16-22)24-17-25-26(18-28(24)41-19-39-6)31(4,5)15-14-30(25,2)3/h8-13,16-18H,7,14-15,19H2,1-6H3 |
| InChIKey | FHMNQDSDPUHWRE-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.69 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|