C42H48O5 — CID 18768196
benzyl 4-[4-(6-ethoxy-6-oxohexoxy)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate (PubChem CID 18768196) has the molecular formula C42H48O5 and a molecular weight of 632.84 g/mol. Its IUPAC name is benzyl 4-[4-(6-ethoxy-6-oxohexoxy)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate.
| Compound Name | benzyl 4-[4-(6-ethoxy-6-oxohexoxy)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 18768196 |
| Molecular Formula | C42H48O5 |
| Molecular Weight | 632.84 g/mol |
| Exact Mass | 632.35 |
| IUPAC Name | benzyl 4-[4-(6-ethoxy-6-oxohexoxy)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate |
| SMILES | CCOC(=O)CCCCCOc1ccc(-c2ccc(C(=O)OCc3ccccc3)cc2)cc1-c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C42H48O5/c1-6-45-39(43)15-11-8-12-26-46-38-23-21-33(31-16-18-32(19-17-31)40(44)47-29-30-13-9-7-10-14-30)27-35(38)34-20-22-36-37(28-34)42(4,5)25-24-41(36,2)3/h7,9-10,13-14,16-23,27-28H,6,8,11-12,15,24-26,29H2,1-5H3 |
| InChIKey | AJLDRPDSNRUEPY-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.84 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|