C31H33F3O5S — CID 18768237
ethyl 4-[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethylsulfonyloxy)phenyl]benzoate (PubChem CID 18768237) has the molecular formula C31H33F3O5S and a molecular weight of 574.66 g/mol. Its IUPAC name is ethyl 4-[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethylsulfonyloxy)phenyl]benzoate.
| Compound Name | ethyl 4-[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethylsulfonyloxy)phenyl]benzoate |
|---|---|
| PubChem CID | 18768237 |
| Molecular Formula | C31H33F3O5S |
| Molecular Weight | 574.66 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | ethyl 4-[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethylsulfonyloxy)phenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(OS(=O)(=O)C(F)(F)F)c(-c3cc4c(cc3C)C(C)(C)CCC4(C)C)c2)cc1 |
| InChI | InChI=1S/C31H33F3O5S/c1-7-38-28(35)21-10-8-20(9-11-21)22-12-13-27(39-40(36,37)31(32,33)34)24(17-22)23-18-26-25(16-19(23)2)29(3,4)14-15-30(26,5)6/h8-13,16-18H,7,14-15H2,1-6H3 |
| InChIKey | UREPDIGPEAYXQD-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.66 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|