C14H13FN2O4S — CID 18768439
2-[2-[(4-fluorophenyl)methylsulfanyl]-5-(hydroxymethyl)-4-oxopyrimidin-1-yl]acetic acid (PubChem CID 18768439) has the molecular formula C14H13FN2O4S and a molecular weight of 324.33 g/mol. Its IUPAC name is 2-[2-[(4-fluorophenyl)methylsulfanyl]-5-(hydroxymethyl)-4-oxopyrimidin-1-yl]acetic acid.
| Compound Name | 2-[2-[(4-fluorophenyl)methylsulfanyl]-5-(hydroxymethyl)-4-oxopyrimidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 18768439 |
| Molecular Formula | C14H13FN2O4S |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-[2-[(4-fluorophenyl)methylsulfanyl]-5-(hydroxymethyl)-4-oxopyrimidin-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CO)c(=O)nc1SCc1ccc(F)cc1 |
| InChI | InChI=1S/C14H13FN2O4S/c15-11-3-1-9(2-4-11)8-22-14-16-13(21)10(7-18)5-17(14)6-12(19)20/h1-5,18H,6-8H2,(H,19,20) |
| InChIKey | BZIQUTYQTOMQFV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |