About 2-[1-(4-bromophenyl)-3-[(2-chloro-6-fluorophenyl)methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid
2-[1-(4-bromophenyl)-3-[(2-chloro-6-fluorophenyl)methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid (PubChem CID 18768533) has the molecular formula C19H17BrClFN2O3
and a molecular weight of 455.71 g/mol. Its IUPAC name is 2-[1-(4-bromophenyl)-3-[(2-chloro-6-fluorophenyl)methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[1-(4-bromophenyl)-3-[(2-chloro-6-fluorophenyl)methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid |
| PubChem CID | 18768533 |
| Molecular Formula | C19H17BrClFN2O3 |
| Molecular Weight | 455.71 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | 2-[1-(4-bromophenyl)-3-[(2-chloro-6-fluorophenyl)methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid |
| SMILES | O=C(O)CC1CN(Cc2c(F)cccc2Cl)C(=O)N(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C19H17BrClFN2O3/c20-13-4-6-14(7-5-13)24-10-12(8-18(25)26)9-23(19(24)27)11-15-16(21)2-1-3-17(15)22/h1-7,12H,8-11H2,(H,25,26) |
| InChIKey | ZKAMDAVQLYSJEU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.71 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-(4-bromophenyl)-3-[(2-chloro-6-fluorophenyl)methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-bromophenyl)-3-[(2-chloro-6-fluorophenyl)methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid?
The IUPAC name of 2-[1-(4-bromophenyl)-3-[(2-chloro-6-fluorophenyl)methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid (CID 18768533) is 2-[1-(4-bromophenyl)-3-[(2-chloro-6-fluorophenyl)methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid.
What is the SMILES notation for 2-[1-(4-bromophenyl)-3-[(2-chloro-6-fluorophenyl)methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid?
The canonical SMILES for 2-[1-(4-bromophenyl)-3-[(2-chloro-6-fluorophenyl)methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid is O=C(O)CC1CN(Cc2c(F)cccc2Cl)C(=O)N(c2ccc(Br)cc2)C1.
What is the InChIKey of 2-[1-(4-bromophenyl)-3-[(2-chloro-6-fluorophenyl)methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid?
The InChIKey is ZKAMDAVQLYSJEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17BrClFN2O3/c20-13-4-6-14(7-5-13)24-10-12(8-18(25)26)9-23(19(24)27)11-15-16(21)2-1-3-17(15)22/h1-7,12H,8-11H2,(H,25,26).
What are the key properties of 2-[1-(4-bromophenyl)-3-[(2-chloro-6-fluorophenyl)methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid?
2-[1-(4-bromophenyl)-3-[(2-chloro-6-fluorophenyl)methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid has a molecular weight of 455.71 g/mol, XLogP of 4.77, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-bromophenyl)-3-[(2-chloro-6-fluorophenyl)methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid is sourced from PubChem (CID 18768533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).