C17H22Cl2N2O4 — CID 18768623
2-[1-[(2,4-dichlorophenyl)methyl]-3-(2-ethoxyethyl)-2-oxo-1,3-diazinan-5-yl]acetic acid (PubChem CID 18768623) has the molecular formula C17H22Cl2N2O4 and a molecular weight of 389.28 g/mol. Its IUPAC name is 2-[1-[(2,4-dichlorophenyl)methyl]-3-(2-ethoxyethyl)-2-oxo-1,3-diazinan-5-yl]acetic acid.
| Compound Name | 2-[1-[(2,4-dichlorophenyl)methyl]-3-(2-ethoxyethyl)-2-oxo-1,3-diazinan-5-yl]acetic acid |
|---|---|
| PubChem CID | 18768623 |
| Molecular Formula | C17H22Cl2N2O4 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-[1-[(2,4-dichlorophenyl)methyl]-3-(2-ethoxyethyl)-2-oxo-1,3-diazinan-5-yl]acetic acid |
| SMILES | CCOCCN1CC(CC(=O)O)CN(Cc2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C17H22Cl2N2O4/c1-2-25-6-5-20-9-12(7-16(22)23)10-21(17(20)24)11-13-3-4-14(18)8-15(13)19/h3-4,8,12H,2,5-7,9-11H2,1H3,(H,22,23) |
| InChIKey | ZXGVDRHEFSLFFC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|