About 1-carbamoyloxyethyl acetate
1-carbamoyloxyethyl acetate (PubChem CID 18769180) has the molecular formula C5H9NO4
and a molecular weight of 147.13 g/mol. Its IUPAC name is 1-carbamoyloxyethyl acetate.
Molecular Properties
| Compound Name | 1-carbamoyloxyethyl acetate |
| PubChem CID | 18769180 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 1-carbamoyloxyethyl acetate |
| SMILES | CC(=O)OC(C)OC(N)=O |
| InChI | InChI=1S/C5H9NO4/c1-3(7)9-4(2)10-5(6)8/h4H,1-2H3,(H2,6,8) |
| InChIKey | VCYBBLXSOSDGKQ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamoyloxyethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamoyloxyethyl acetate?
The IUPAC name of 1-carbamoyloxyethyl acetate (CID 18769180) is 1-carbamoyloxyethyl acetate.
What is the SMILES notation for 1-carbamoyloxyethyl acetate?
The canonical SMILES for 1-carbamoyloxyethyl acetate is CC(=O)OC(C)OC(N)=O.
What is the InChIKey of 1-carbamoyloxyethyl acetate?
The InChIKey is VCYBBLXSOSDGKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO4/c1-3(7)9-4(2)10-5(6)8/h4H,1-2H3,(H2,6,8).
What are the key properties of 1-carbamoyloxyethyl acetate?
1-carbamoyloxyethyl acetate has a molecular weight of 147.13 g/mol, XLogP of -0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamoyloxyethyl acetate is sourced from PubChem (CID 18769180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).