C11H16Cl2N4 — CID 18769494
1-benzyl-3-methylpyrazole-4,5-diamine;dihydrochloride (PubChem CID 18769494) has the molecular formula C11H16Cl2N4 and a molecular weight of 275.18 g/mol. Its IUPAC name is 1-benzyl-3-methylpyrazole-4,5-diamine;dihydrochloride.
| Compound Name | 1-benzyl-3-methylpyrazole-4,5-diamine;dihydrochloride |
|---|---|
| PubChem CID | 18769494 |
| Molecular Formula | C11H16Cl2N4 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-benzyl-3-methylpyrazole-4,5-diamine;dihydrochloride |
| SMILES | Cc1nn(Cc2ccccc2)c(N)c1N.Cl.Cl |
| InChI | InChI=1S/C11H14N4.2ClH/c1-8-10(12)11(13)15(14-8)7-9-5-3-2-4-6-9;;/h2-6H,7,12-13H2,1H3;2*1H |
| InChIKey | YPQFQMAVQUYRJA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |