About methyl 1-(benzenesulfonyl)-4,4-difluoropyrrolidine-2-carboxylate
methyl 1-(benzenesulfonyl)-4,4-difluoropyrrolidine-2-carboxylate (PubChem CID 18770177) has the molecular formula C12H13F2NO4S
and a molecular weight of 305.30 g/mol. Its IUPAC name is methyl 1-(benzenesulfonyl)-4,4-difluoropyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(benzenesulfonyl)-4,4-difluoropyrrolidine-2-carboxylate |
| PubChem CID | 18770177 |
| Molecular Formula | C12H13F2NO4S |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | methyl 1-(benzenesulfonyl)-4,4-difluoropyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(F)(F)CN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H13F2NO4S/c1-19-11(16)10-7-12(13,14)8-15(10)20(17,18)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3 |
| InChIKey | WVKDOPSYDFOXRB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1-(benzenesulfonyl)-4,4-difluoropyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(benzenesulfonyl)-4,4-difluoropyrrolidine-2-carboxylate?
The IUPAC name of methyl 1-(benzenesulfonyl)-4,4-difluoropyrrolidine-2-carboxylate (CID 18770177) is methyl 1-(benzenesulfonyl)-4,4-difluoropyrrolidine-2-carboxylate.
What is the SMILES notation for methyl 1-(benzenesulfonyl)-4,4-difluoropyrrolidine-2-carboxylate?
The canonical SMILES for methyl 1-(benzenesulfonyl)-4,4-difluoropyrrolidine-2-carboxylate is COC(=O)C1CC(F)(F)CN1S(=O)(=O)c1ccccc1.
What is the InChIKey of methyl 1-(benzenesulfonyl)-4,4-difluoropyrrolidine-2-carboxylate?
The InChIKey is WVKDOPSYDFOXRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2NO4S/c1-19-11(16)10-7-12(13,14)8-15(10)20(17,18)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3.
What are the key properties of methyl 1-(benzenesulfonyl)-4,4-difluoropyrrolidine-2-carboxylate?
methyl 1-(benzenesulfonyl)-4,4-difluoropyrrolidine-2-carboxylate has a molecular weight of 305.30 g/mol, XLogP of 1.26, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(benzenesulfonyl)-4,4-difluoropyrrolidine-2-carboxylate is sourced from PubChem (CID 18770177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).