C18H15Cl4FN6O — CID 18770543
4-chloro-2-fluoro-N-[2,2,2-trichloro-1-[(E)-[(cyanoamino)-[(4-ethyl-3-pyridinyl)amino]methylidene]amino]ethyl]benzamide (PubChem CID 18770543) has the molecular formula C18H15Cl4FN6O and a molecular weight of 492.17 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-[2,2,2-trichloro-1-[(E)-[(cyanoamino)-[(4-ethyl-3-pyridinyl)amino]methylidene]amino]ethyl]benzamide.
| Compound Name | 4-chloro-2-fluoro-N-[2,2,2-trichloro-1-[(E)-[(cyanoamino)-[(4-ethyl-3-pyridinyl)amino]methylidene]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 18770543 |
| Molecular Formula | C18H15Cl4FN6O |
| Molecular Weight | 492.17 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | 4-chloro-2-fluoro-N-[2,2,2-trichloro-1-[(E)-[(cyanoamino)-[(4-ethyl-3-pyridinyl)amino]methylidene]amino]ethyl]benzamide |
| SMILES | CCc1ccncc1N/C(=N\C(NC(=O)c1ccc(Cl)cc1F)C(Cl)(Cl)Cl)NC#N |
| InChI | InChI=1S/C18H15Cl4FN6O/c1-2-10-5-6-25-8-14(10)27-17(26-9-24)29-16(18(20,21)22)28-15(30)12-4-3-11(19)7-13(12)23/h3-8,16H,2H2,1H3,(H,28,30)(H2,26,27,29) |
| InChIKey | LTURLFXWXWNOHQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.17 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|