C25H24ClFN6O3S — CID 18770609
4-chloro-N-[1-[(E)-[(cyanoamino)-[[5-(4-fluorophenyl)sulfonyl-3-pyridinyl]amino]methylidene]amino]-2,2-dimethylpropyl]benzamide (PubChem CID 18770609) has the molecular formula C25H24ClFN6O3S and a molecular weight of 543.02 g/mol. Its IUPAC name is 4-chloro-N-[1-[(E)-[(cyanoamino)-[[5-(4-fluorophenyl)sulfonyl-3-pyridinyl]amino]methylidene]amino]-2,2-dimethylpropyl]benzamide.
| Compound Name | 4-chloro-N-[1-[(E)-[(cyanoamino)-[[5-(4-fluorophenyl)sulfonyl-3-pyridinyl]amino]methylidene]amino]-2,2-dimethylpropyl]benzamide |
|---|---|
| PubChem CID | 18770609 |
| Molecular Formula | C25H24ClFN6O3S |
| Molecular Weight | 543.02 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | 4-chloro-N-[1-[(E)-[(cyanoamino)-[[5-(4-fluorophenyl)sulfonyl-3-pyridinyl]amino]methylidene]amino]-2,2-dimethylpropyl]benzamide |
| SMILES | CC(C)(C)C(/N=C(/NC#N)Nc1cncc(S(=O)(=O)c2ccc(F)cc2)c1)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H24ClFN6O3S/c1-25(2,3)23(32-22(34)16-4-6-17(26)7-5-16)33-24(30-15-28)31-19-12-21(14-29-13-19)37(35,36)20-10-8-18(27)9-11-20/h4-14,23H,1-3H3,(H,32,34)(H2,30,31,33) |
| InChIKey | COFCRXXHOLSNFA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.02 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|