C18H19ClN6OS — CID 18770618
4-chloro-N-[1-[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-3-methylsulfanylpropyl]benzamide (PubChem CID 18770618) has the molecular formula C18H19ClN6OS and a molecular weight of 402.91 g/mol. Its IUPAC name is 4-chloro-N-[1-[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-3-methylsulfanylpropyl]benzamide.
| Compound Name | 4-chloro-N-[1-[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-3-methylsulfanylpropyl]benzamide |
|---|---|
| PubChem CID | 18770618 |
| Molecular Formula | C18H19ClN6OS |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 4-chloro-N-[1-[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-3-methylsulfanylpropyl]benzamide |
| SMILES | CSCCC(/N=C(/NC#N)Nc1cccnc1)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19ClN6OS/c1-27-10-8-16(24-17(26)13-4-6-14(19)7-5-13)25-18(22-12-20)23-15-3-2-9-21-11-15/h2-7,9,11,16H,8,10H2,1H3,(H,24,26)(H2,22,23,25) |
| InChIKey | BXZRDBSKJUZSFC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|