C18H20N6O2S — CID 18771665
1-[6-[(3-hydroxypropylamino)methyl]-2-pyridinyl]-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)urea (PubChem CID 18771665) has the molecular formula C18H20N6O2S and a molecular weight of 384.47 g/mol. Its IUPAC name is 1-[6-[(3-hydroxypropylamino)methyl]-2-pyridinyl]-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-[6-[(3-hydroxypropylamino)methyl]-2-pyridinyl]-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 18771665 |
| Molecular Formula | C18H20N6O2S |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-[6-[(3-hydroxypropylamino)methyl]-2-pyridinyl]-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)urea |
| SMILES | O=C(Nc1cccc(CNCCCO)n1)Nc1csc(-c2ccncc2)n1 |
| InChI | InChI=1S/C18H20N6O2S/c25-10-2-7-20-11-14-3-1-4-15(21-14)23-18(26)24-16-12-27-17(22-16)13-5-8-19-9-6-13/h1,3-6,8-9,12,20,25H,2,7,10-11H2,(H2,21,23,24,26) |
| InChIKey | QRKSGQJNYNRMBR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|