About 1-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-3-[6-(piperidin-1-ylmethyl)-2-pyridinyl]urea
1-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-3-[6-(piperidin-1-ylmethyl)-2-pyridinyl]urea (PubChem CID 18771919) has the molecular formula C21H22FN5OS
and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-3-[6-(piperidin-1-ylmethyl)-2-pyridinyl]urea.
Molecular Properties
| Compound Name | 1-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-3-[6-(piperidin-1-ylmethyl)-2-pyridinyl]urea |
| PubChem CID | 18771919 |
| Molecular Formula | C21H22FN5OS |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-3-[6-(piperidin-1-ylmethyl)-2-pyridinyl]urea |
| SMILES | O=C(Nc1cccc(CN2CCCCC2)n1)Nc1csc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C21H22FN5OS/c22-16-7-4-6-15(12-16)20-24-19(14-29-20)26-21(28)25-18-9-5-8-17(23-18)13-27-10-2-1-3-11-27/h4-9,12,14H,1-3,10-11,13H2,(H2,23,25,26,28) |
| InChIKey | WHZKQODLTPMKCG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-3-[6-(piperidin-1-ylmethyl)-2-pyridinyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-3-[6-(piperidin-1-ylmethyl)-2-pyridinyl]urea?
The IUPAC name of 1-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-3-[6-(piperidin-1-ylmethyl)-2-pyridinyl]urea (CID 18771919) is 1-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-3-[6-(piperidin-1-ylmethyl)-2-pyridinyl]urea.
What is the SMILES notation for 1-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-3-[6-(piperidin-1-ylmethyl)-2-pyridinyl]urea?
The canonical SMILES for 1-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-3-[6-(piperidin-1-ylmethyl)-2-pyridinyl]urea is O=C(Nc1cccc(CN2CCCCC2)n1)Nc1csc(-c2cccc(F)c2)n1.
What is the InChIKey of 1-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-3-[6-(piperidin-1-ylmethyl)-2-pyridinyl]urea?
The InChIKey is WHZKQODLTPMKCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FN5OS/c22-16-7-4-6-15(12-16)20-24-19(14-29-20)26-21(28)25-18-9-5-8-17(23-18)13-27-10-2-1-3-11-27/h4-9,12,14H,1-3,10-11,13H2,(H2,23,25,26,28).
What are the key properties of 1-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-3-[6-(piperidin-1-ylmethyl)-2-pyridinyl]urea?
1-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-3-[6-(piperidin-1-ylmethyl)-2-pyridinyl]urea has a molecular weight of 411.51 g/mol, XLogP of 4.97, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-3-[6-(piperidin-1-ylmethyl)-2-pyridinyl]urea is sourced from PubChem (CID 18771919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).