C13H19BrN2O2 — CID 18771920
6-bromo-N-[3-(oxan-2-yloxy)propyl]pyridin-2-amine (PubChem CID 18771920) has the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. Its IUPAC name is 6-bromo-N-[3-(oxan-2-yloxy)propyl]pyridin-2-amine.
| Compound Name | 6-bromo-N-[3-(oxan-2-yloxy)propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 18771920 |
| Molecular Formula | C13H19BrN2O2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 6-bromo-N-[3-(oxan-2-yloxy)propyl]pyridin-2-amine |
| SMILES | Brc1cccc(NCCCOC2CCCCO2)n1 |
| InChI | InChI=1S/C13H19BrN2O2/c14-11-5-3-6-12(16-11)15-8-4-10-18-13-7-1-2-9-17-13/h3,5-6,13H,1-2,4,7-10H2,(H,15,16) |
| InChIKey | VCCVAISWBVGZDU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|