About 2-(2-aminoethoxy)ethanol;3,6-dichloro-2-methoxybenzoic acid
2-(2-aminoethoxy)ethanol;3,6-dichloro-2-methoxybenzoic acid (PubChem CID 18772449) has the molecular formula C12H17Cl2NO5
and a molecular weight of 326.18 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethanol;3,6-dichloro-2-methoxybenzoic acid.
Molecular Properties
| Compound Name | 2-(2-aminoethoxy)ethanol;3,6-dichloro-2-methoxybenzoic acid |
| PubChem CID | 18772449 |
| Molecular Formula | C12H17Cl2NO5 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-(2-aminoethoxy)ethanol;3,6-dichloro-2-methoxybenzoic acid |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)O.NCCOCCO |
| InChI | InChI=1S/C8H6Cl2O3.C4H11NO2/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;5-1-3-7-4-2-6/h2-3H,1H3,(H,11,12);6H,1-5H2 |
| InChIKey | QURLONWWPWCPIC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethoxy)ethanol;3,6-dichloro-2-methoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethoxy)ethanol;3,6-dichloro-2-methoxybenzoic acid?
The IUPAC name of 2-(2-aminoethoxy)ethanol;3,6-dichloro-2-methoxybenzoic acid (CID 18772449) is 2-(2-aminoethoxy)ethanol;3,6-dichloro-2-methoxybenzoic acid.
What is the SMILES notation for 2-(2-aminoethoxy)ethanol;3,6-dichloro-2-methoxybenzoic acid?
The canonical SMILES for 2-(2-aminoethoxy)ethanol;3,6-dichloro-2-methoxybenzoic acid is COc1c(Cl)ccc(Cl)c1C(=O)O.NCCOCCO.
What is the InChIKey of 2-(2-aminoethoxy)ethanol;3,6-dichloro-2-methoxybenzoic acid?
The InChIKey is QURLONWWPWCPIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2O3.C4H11NO2/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;5-1-3-7-4-2-6/h2-3H,1H3,(H,11,12);6H,1-5H2.
What are the key properties of 2-(2-aminoethoxy)ethanol;3,6-dichloro-2-methoxybenzoic acid?
2-(2-aminoethoxy)ethanol;3,6-dichloro-2-methoxybenzoic acid has a molecular weight of 326.18 g/mol, XLogP of 1.65, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethoxy)ethanol;3,6-dichloro-2-methoxybenzoic acid is sourced from PubChem (CID 18772449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).