C18H28O2 — CID 18772461
prop-2-ynyl (2E,4E,7S)-3,7,11-trimethyldodeca-2,4-dienoate (PubChem CID 18772461) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is prop-2-ynyl (2E,4E,7S)-3,7,11-trimethyldodeca-2,4-dienoate.
| Compound Name | prop-2-ynyl (2E,4E,7S)-3,7,11-trimethyldodeca-2,4-dienoate |
|---|---|
| PubChem CID | 18772461 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | prop-2-ynyl (2E,4E,7S)-3,7,11-trimethyldodeca-2,4-dienoate |
| SMILES | C#CCOC(=O)/C=C(C)/C=C/C[C@@H](C)CCCC(C)C |
| InChI | InChI=1S/C18H28O2/c1-6-13-20-18(19)14-17(5)12-8-11-16(4)10-7-9-15(2)3/h1,8,12,14-16H,7,9-11,13H2,2-5H3/b12-8+,17-14+/t16-/m0/s1 |
| InChIKey | FZRBKIRIBLNOAM-PBGROSLGSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|