C14H13ClFN3O3S2 — CID 18772468
2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetic acid (PubChem CID 18772468) has the molecular formula C14H13ClFN3O3S2 and a molecular weight of 389.86 g/mol. Its IUPAC name is 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetic acid.
| Compound Name | 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 18772468 |
| Molecular Formula | C14H13ClFN3O3S2 |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1cc(/N=c2\sc(=O)n3n2CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C14H13ClFN3O3S2/c15-8-5-9(16)10(6-11(8)23-7-12(20)21)17-13-18-3-1-2-4-19(18)14(22)24-13/h5-6H,1-4,7H2,(H,20,21)/b17-13- |
| InChIKey | XWROTTLWMHCFEC-LGMDPLHJSA-N |
| XLogP | 2.71 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |