C21H19BrN2O3S2 — CID 18772962
N-(4-bromo-2,6-dimethylphenyl)-2-[4-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide (PubChem CID 18772962) has the molecular formula C21H19BrN2O3S2 and a molecular weight of 491.43 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-2-[4-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-2-[4-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 18772962 |
| Molecular Formula | C21H19BrN2O3S2 |
| Molecular Weight | 491.43 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-2-[4-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)COc1ccc(/C=C2/SC(=S)N(C)C2=O)cc1 |
| InChI | InChI=1S/C21H19BrN2O3S2/c1-12-8-15(22)9-13(2)19(12)23-18(25)11-27-16-6-4-14(5-7-16)10-17-20(26)24(3)21(28)29-17/h4-10H,11H2,1-3H3,(H,23,25)/b17-10+ |
| InChIKey | XTGFEVZOJFEYIG-LICLKQGHSA-N |
| XLogP | 4.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|