C23H22ClN5O3S — CID 18773662
2-[[5-(1-benzofuran-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chloro-4-morpholin-4-ylphenyl)acetamide (PubChem CID 18773662) has the molecular formula C23H22ClN5O3S and a molecular weight of 483.98 g/mol. Its IUPAC name is 2-[[5-(1-benzofuran-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chloro-4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[[5-(1-benzofuran-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chloro-4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 18773662 |
| Molecular Formula | C23H22ClN5O3S |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 2-[[5-(1-benzofuran-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chloro-4-morpholin-4-ylphenyl)acetamide |
| SMILES | Cn1c(SCC(=O)Nc2ccc(N3CCOCC3)c(Cl)c2)nnc1-c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H22ClN5O3S/c1-28-22(20-12-15-4-2-3-5-19(15)32-20)26-27-23(28)33-14-21(30)25-16-6-7-18(17(24)13-16)29-8-10-31-11-9-29/h2-7,12-13H,8-11,14H2,1H3,(H,25,30) |
| InChIKey | GCBOJZOGWNOJPS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|