C16H24N4O5S2 — CID 18774664
N-[4-(diethylamino)phenyl]-2-(1-methylimidazol-2-yl)sulfanylacetamide;sulfuric acid (PubChem CID 18774664) has the molecular formula C16H24N4O5S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-2-(1-methylimidazol-2-yl)sulfanylacetamide;sulfuric acid.
| Compound Name | N-[4-(diethylamino)phenyl]-2-(1-methylimidazol-2-yl)sulfanylacetamide;sulfuric acid |
|---|---|
| PubChem CID | 18774664 |
| Molecular Formula | C16H24N4O5S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-2-(1-methylimidazol-2-yl)sulfanylacetamide;sulfuric acid |
| SMILES | CCN(CC)c1ccc(NC(=O)CSc2nccn2C)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C16H22N4OS.H2O4S/c1-4-20(5-2)14-8-6-13(7-9-14)18-15(21)12-22-16-17-10-11-19(16)3;1-5(2,3)4/h6-11H,4-5,12H2,1-3H3,(H,18,21);(H2,1,2,3,4) |
| InChIKey | WFPXCHQBHYNKQE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|