About 2-(2,5-dichlorophenyl)sulfanyl-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride
2-(2,5-dichlorophenyl)sulfanyl-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride (PubChem CID 18774666) has the molecular formula C14H16Cl3N3OS
and a molecular weight of 380.73 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride |
| PubChem CID | 18774666 |
| Molecular Formula | C14H16Cl3N3OS |
| Molecular Weight | 380.73 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CSc1cc(Cl)ccc1Cl)NCCCn1ccnc1 |
| InChI | InChI=1S/C14H15Cl2N3OS.ClH/c15-11-2-3-12(16)13(8-11)21-9-14(20)18-4-1-6-19-7-5-17-10-19;/h2-3,5,7-8,10H,1,4,6,9H2,(H,18,20);1H |
| InChIKey | DDFZTBLYHIAINY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.73 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dichlorophenyl)sulfanyl-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dichlorophenyl)sulfanyl-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride?
The IUPAC name of 2-(2,5-dichlorophenyl)sulfanyl-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride (CID 18774666) is 2-(2,5-dichlorophenyl)sulfanyl-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride.
What is the SMILES notation for 2-(2,5-dichlorophenyl)sulfanyl-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride?
The canonical SMILES for 2-(2,5-dichlorophenyl)sulfanyl-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride is Cl.O=C(CSc1cc(Cl)ccc1Cl)NCCCn1ccnc1.
What is the InChIKey of 2-(2,5-dichlorophenyl)sulfanyl-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride?
The InChIKey is DDFZTBLYHIAINY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2N3OS.ClH/c15-11-2-3-12(16)13(8-11)21-9-14(20)18-4-1-6-19-7-5-17-10-19;/h2-3,5,7-8,10H,1,4,6,9H2,(H,18,20);1H.
What are the key properties of 2-(2,5-dichlorophenyl)sulfanyl-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride?
2-(2,5-dichlorophenyl)sulfanyl-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride has a molecular weight of 380.73 g/mol, XLogP of 3.91, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dichlorophenyl)sulfanyl-N-(3-imidazol-1-ylpropyl)acetamide;hydrochloride is sourced from PubChem (CID 18774666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).