C19H18N4O5S — CID 18775433
N-[3-[(2-methoxyphenyl)sulfamoyl]phenyl]-1-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 18775433) has the molecular formula C19H18N4O5S and a molecular weight of 414.44 g/mol. Its IUPAC name is N-[3-[(2-methoxyphenyl)sulfamoyl]phenyl]-1-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[3-[(2-methoxyphenyl)sulfamoyl]phenyl]-1-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 18775433 |
| Molecular Formula | C19H18N4O5S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-[3-[(2-methoxyphenyl)sulfamoyl]phenyl]-1-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cccc(NC(=O)c2ccc(=O)n(C)n2)c1 |
| InChI | InChI=1S/C19H18N4O5S/c1-23-18(24)11-10-16(21-23)19(25)20-13-6-5-7-14(12-13)29(26,27)22-15-8-3-4-9-17(15)28-2/h3-12,22H,1-2H3,(H,20,25) |
| InChIKey | SHIWPMNPNNQMGT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |