C13H15F3N2O3 — CID 18775642
(2S)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 18775642) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | (2S)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 18775642 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (2S)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | C[C@@H](C(=O)NCC(F)(F)F)N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C13H15F3N2O3/c1-7(10(19)17-6-13(14,15)16)18-11(20)8-4-2-3-5-9(8)12(18)21/h2-3,7-9H,4-6H2,1H3,(H,17,19)/t7-,8?,9?/m0/s1 |
| InChIKey | IXBGIGUEDFLJII-UEJVZZJDSA-N |
| XLogP | 1.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|