C10H13N3O2 — CID 18776246
3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanenitrile (PubChem CID 18776246) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanenitrile.
| Compound Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanenitrile |
|---|---|
| PubChem CID | 18776246 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanenitrile |
| SMILES | N#CCCN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C10H13N3O2/c11-6-3-7-13-8(14)10(12-9(13)15)4-1-2-5-10/h1-5,7H2,(H,12,15) |
| InChIKey | PGESNTIBOXIKOR-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|