About (E)-3-amino-2-[2-(3,4-difluorophenyl)sulfanylacetyl]but-2-enenitrile
(E)-3-amino-2-[2-(3,4-difluorophenyl)sulfanylacetyl]but-2-enenitrile (PubChem CID 18776643) has the molecular formula C12H10F2N2OS
and a molecular weight of 268.29 g/mol. Its IUPAC name is (E)-3-amino-2-[2-(3,4-difluorophenyl)sulfanylacetyl]but-2-enenitrile.
Molecular Properties
| Compound Name | (E)-3-amino-2-[2-(3,4-difluorophenyl)sulfanylacetyl]but-2-enenitrile |
| PubChem CID | 18776643 |
| Molecular Formula | C12H10F2N2OS |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | (E)-3-amino-2-[2-(3,4-difluorophenyl)sulfanylacetyl]but-2-enenitrile |
| SMILES | C/C(N)=C(/C#N)C(=O)CSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H10F2N2OS/c1-7(16)9(5-15)12(17)6-18-8-2-3-10(13)11(14)4-8/h2-4H,6,16H2,1H3/b9-7+ |
| InChIKey | SRMVCECDIZCCNU-VQHVLOKHSA-N |
| XLogP | 2.38 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-amino-2-[2-(3,4-difluorophenyl)sulfanylacetyl]but-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-amino-2-[2-(3,4-difluorophenyl)sulfanylacetyl]but-2-enenitrile?
The IUPAC name of (E)-3-amino-2-[2-(3,4-difluorophenyl)sulfanylacetyl]but-2-enenitrile (CID 18776643) is (E)-3-amino-2-[2-(3,4-difluorophenyl)sulfanylacetyl]but-2-enenitrile.
What is the SMILES notation for (E)-3-amino-2-[2-(3,4-difluorophenyl)sulfanylacetyl]but-2-enenitrile?
The canonical SMILES for (E)-3-amino-2-[2-(3,4-difluorophenyl)sulfanylacetyl]but-2-enenitrile is C/C(N)=C(/C#N)C(=O)CSc1ccc(F)c(F)c1.
What is the InChIKey of (E)-3-amino-2-[2-(3,4-difluorophenyl)sulfanylacetyl]but-2-enenitrile?
The InChIKey is SRMVCECDIZCCNU-VQHVLOKHSA-N. The full InChI is InChI=1S/C12H10F2N2OS/c1-7(16)9(5-15)12(17)6-18-8-2-3-10(13)11(14)4-8/h2-4H,6,16H2,1H3/b9-7+.
What are the key properties of (E)-3-amino-2-[2-(3,4-difluorophenyl)sulfanylacetyl]but-2-enenitrile?
(E)-3-amino-2-[2-(3,4-difluorophenyl)sulfanylacetyl]but-2-enenitrile has a molecular weight of 268.29 g/mol, XLogP of 2.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-amino-2-[2-(3,4-difluorophenyl)sulfanylacetyl]but-2-enenitrile is sourced from PubChem (CID 18776643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).