C13H14N6OS — CID 18777166
(E)-3-amino-2-[2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetyl]but-2-enenitrile (PubChem CID 18777166) has the molecular formula C13H14N6OS and a molecular weight of 302.36 g/mol. Its IUPAC name is (E)-3-amino-2-[2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetyl]but-2-enenitrile.
| Compound Name | (E)-3-amino-2-[2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetyl]but-2-enenitrile |
|---|---|
| PubChem CID | 18777166 |
| Molecular Formula | C13H14N6OS |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (E)-3-amino-2-[2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetyl]but-2-enenitrile |
| SMILES | C/C(N)=C(/C#N)C(=O)CSc1nnc2nc(C)cc(C)n12 |
| InChI | InChI=1S/C13H14N6OS/c1-7-4-8(2)19-12(16-7)17-18-13(19)21-6-11(20)10(5-14)9(3)15/h4H,6,15H2,1-3H3/b10-9+ |
| InChIKey | NHENHHAXKDDOKK-MDZDMXLPSA-N |
| XLogP | 1.16 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|