C12H11BrN2OS — CID 18777944
(E)-3-(5-bromothiophen-2-yl)-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile (PubChem CID 18777944) has the molecular formula C12H11BrN2OS and a molecular weight of 311.20 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 18777944 |
| Molecular Formula | C12H11BrN2OS |
| Molecular Weight | 311.20 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(Br)s1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C12H11BrN2OS/c13-11-4-3-10(17-11)7-9(8-14)12(16)15-5-1-2-6-15/h3-4,7H,1-2,5-6H2/b9-7+ |
| InChIKey | ZQSYCXQJCURAGC-VQHVLOKHSA-N |
| XLogP | 3.04 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|