About CID 18779470
CID 18779470 (PubChem CID 18779470) has the molecular formula C20H19OSi
and a molecular weight of 303.46 g/mol.
Molecular Properties
| Compound Name | CID 18779470 |
| PubChem CID | 18779470 |
| Molecular Formula | C20H19OSi |
| Molecular Weight | 303.46 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | — |
| SMILES | CCO[Si](C1C=Cc2ccccc21)C1C=Cc2ccccc21 |
| InChI | InChI=1S/C20H19OSi/c1-2-21-22(19-13-11-15-7-3-5-9-17(15)19)20-14-12-16-8-4-6-10-18(16)20/h3-14,19-20H,2H2,1H3 |
| InChIKey | SGVCQXKUPSXHDW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 18779470 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18779470?
The IUPAC name of CID 18779470 (CID 18779470) is not available.
What is the SMILES notation for CID 18779470?
The canonical SMILES for CID 18779470 is CCO[Si](C1C=Cc2ccccc21)C1C=Cc2ccccc21.
What is the InChIKey of CID 18779470?
The InChIKey is SGVCQXKUPSXHDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19OSi/c1-2-21-22(19-13-11-15-7-3-5-9-17(15)19)20-14-12-16-8-4-6-10-18(16)20/h3-14,19-20H,2H2,1H3.
What are the key properties of CID 18779470?
CID 18779470 has a molecular weight of 303.46 g/mol, XLogP of 4.71, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18779470 is sourced from PubChem (CID 18779470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).